Products 2243521-41-5
CAS 2243521-41-5 is the registry number for 2-Amino-1-(2,4-difluorophenyl)propan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-1-(2,4-difluorophenyl)propan-1-one;hydrochloride (CAS 2243521-41-5) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: 2-amino-1-(2,4-difluorophenyl)propan-1-one;hydrochloride. InChIKey: JOVSYIZWIPNJTE-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO |
|---|---|
| Molecular weight | 221.63 g/mol |
| IUPAC name | 2-amino-1-(2,4-difluorophenyl)propan-1-one;hydrochloride |
| InChIKey | JOVSYIZWIPNJTE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=C(C=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)