Products 2247101-96-6
CAS 2247101-96-6 is the registry number for 1-(Hydroxymethyl)-3-methyl-2-oxabicyclo(2.1.1)hexane-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(hydroxymethyl)-3-methyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid (CAS 2247101-96-6) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: 1-(hydroxymethyl)-3-methyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid. InChIKey: OXVCEMMNWPCGPB-UHFFFAOYSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 1-(hydroxymethyl)-3-methyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid |
| InChIKey | OXVCEMMNWPCGPB-UHFFFAOYSA-N |
| SMILES | CC1C2(CC(C2)(O1)CO)C(=O)O |
Computed by PubChem (NCBI)