Products 2247102-57-2
CAS 2247102-57-2 is the registry number for 4-Amino-7-chloronaphthalen-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-amino-7-chloronaphthalen-1-ol;hydrochloride (CAS 2247102-57-2) is a chemical compound with the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. IUPAC name: 4-amino-7-chloronaphthalen-1-ol;hydrochloride. InChIKey: LVOMDFLQAMCXTR-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 4-amino-7-chloronaphthalen-1-ol;hydrochloride |
| InChIKey | LVOMDFLQAMCXTR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C=C1Cl)O)N.Cl |
Computed by PubChem (NCBI)