Products 22482-74-2
CAS 22482-74-2 appears in our catalog under these names: 2-(Carboxymethyl)-3-chlorobenzoic acid, 2-(CARBOXYMETHYL)-3-CHLOROBENZOIC ACID, 95%, 2-(Carboxymethyl)-3-chlorobenzoic acid, 95%, 95%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
2-(carboxymethyl)-3-chlorobenzoic acid (CAS 22482-74-2) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: 2-(carboxymethyl)-3-chlorobenzoic acid. InChIKey: HARZEJOUACLTDB-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 2-(carboxymethyl)-3-chlorobenzoic acid |
| InChIKey | HARZEJOUACLTDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)