Products 2250244-07-4
CAS 2250244-07-4 is the registry number for Lercanidipine-D impurity 6. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
(1-chloro-2-methylpropan-2-yl) (E)-3-phenylprop-2-enoate (CAS 2250244-07-4) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: (1-chloro-2-methylpropan-2-yl) (E)-3-phenylprop-2-enoate. InChIKey: UUMVHZWBPFRKNU-CMDGGOBGSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | (1-chloro-2-methylpropan-2-yl) (E)-3-phenylprop-2-enoate |
| InChIKey | UUMVHZWBPFRKNU-CMDGGOBGSA-N |
| SMILES | CC(C)(CCl)OC(=O)/C=C/C1=CC=CC=C1 |
Computed by PubChem (NCBI)