CAS 2251689-60-6 is the registry number for TNF-α-IN-22. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methoxy-1-[(E)-2-nitroethenyl]naphthalene (CAS 2251689-60-6) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 3-methoxy-1-[(E)-2-nitroethenyl]naphthalene. InChIKey: JLEXTNHKFNVKNS-VOTSOKGWSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 3-methoxy-1-[(E)-2-nitroethenyl]naphthalene |
| InChIKey | JLEXTNHKFNVKNS-VOTSOKGWSA-N |
| SMILES | COC1=CC2=CC=CC=C2C(=C1)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)