CAS 2253641-19-7 is the registry number for rac-(3aR,7aS)-Octahydro-1H-indole-3a-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxylic acid;hydrochloride (CAS 2253641-19-7) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: (3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxylic acid;hydrochloride. InChIKey: KEWWDQKNUGJTMH-DKXTVVGFSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | (3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxylic acid;hydrochloride |
| InChIKey | KEWWDQKNUGJTMH-DKXTVVGFSA-N |
| SMILES | C1CC[C@]2(CCN[C@H]2C1)C(=O)O.Cl |
Computed by PubChem (NCBI)