Products 2269482-26-8
CAS 2269482-26-8 appears in our catalog under these names: K–TMZ, K-TMZ. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, Get quote.
8-acetyl-3-methyl-1,2-dihydroimidazo[5,1-d][1,2,3,5]tetrazin-4-one (CAS 2269482-26-8) is a chemical compound with the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. IUPAC name: 8-acetyl-3-methyl-1,2-dihydroimidazo[5,1-d][1,2,3,5]tetrazin-4-one. InChIKey: HYUDMOQAASVUJI-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O2 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 8-acetyl-3-methyl-1,2-dihydroimidazo[5,1-d][1,2,3,5]tetrazin-4-one |
| InChIKey | HYUDMOQAASVUJI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2NNN(C(=O)N2C=N1)C |
Computed by PubChem (NCBI)