CAS 2287289-59-0 is the registry number for 4-(5,6,7,8-Tetrahydronaphthalen-1-yl)-1H-pyrazole hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(5,6,7,8-tetrahydronaphthalen-1-yl)-1H-pyrazole;hydrochloride (CAS 2287289-59-0) is a chemical compound with the molecular formula C13H15ClN2 and a molecular weight of 234.72 g/mol. IUPAC name: 4-(5,6,7,8-tetrahydronaphthalen-1-yl)-1H-pyrazole;hydrochloride. InChIKey: DIVQIQNYTUNJPA-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | 4-(5,6,7,8-tetrahydronaphthalen-1-yl)-1H-pyrazole;hydrochloride |
| InChIKey | DIVQIQNYTUNJPA-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC=C2C3=CNN=C3.Cl |
Computed by PubChem (NCBI)