Products 2287301-33-9

CAS 2287301-33-9 is the registry number for 8-tert-Butyl 3-methyl 1-oxa-8-azaspiro(4.5)dec-3-ene-3,8-dicarboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

8-O-tert-butyl 3-O-methyl 1-oxa-8-azaspiro[4.5]dec-3-ene-3,8-dicarboxylate (CAS 2287301-33-9) is a chemical compound with the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. IUPAC name: 8-O-tert-butyl 3-O-methyl 1-oxa-8-azaspiro[4.5]dec-3-ene-3,8-dicarboxylate. InChIKey: USGQXXPQDUNMHK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23NO5
Molecular weight297.35 g/mol
IUPAC name8-O-tert-butyl 3-O-methyl 1-oxa-8-azaspiro[4.5]dec-3-ene-3,8-dicarboxylate
InChIKeyUSGQXXPQDUNMHK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CC1)C=C(CO2)C(=O)OC

Computed by PubChem (NCBI)