CAS 22966-24-1 is the registry number for (2E)-1-(3-methoxyphenyl)-3-phenylprop-2-en-1-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(E)-1-(3-methoxyphenyl)-3-phenylprop-2-en-1-one (CAS 22966-24-1) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: (E)-1-(3-methoxyphenyl)-3-phenylprop-2-en-1-one. InChIKey: YBUUDNGHUKBXSG-ZHACJKMWSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (E)-1-(3-methoxyphenyl)-3-phenylprop-2-en-1-one |
| InChIKey | YBUUDNGHUKBXSG-ZHACJKMWSA-N |
| SMILES | COC1=CC=CC(=C1)C(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)