Products 2303-35-7
CAS 2303-35-7 appears in our catalog under these names: (+)-Muscarine Chloride, >95% (HPLC), (+)–Muscarine (chloride), (+)-Muscarine chloride, Muscarine (chloride), 99.0%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 2mg, 5 mg.
[(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium chloride (CAS 2303-35-7) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium chloride. InChIKey: WUFRNEJYZWHXLC-CTERPIQNSA-M.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium chloride |
| InChIKey | WUFRNEJYZWHXLC-CTERPIQNSA-M |
| SMILES | C[C@H]1[C@@H](C[C@H](O1)C[N+](C)(C)C)O.[Cl-] |
Computed by PubChem (NCBI)