Products 35119-35-8
CAS 35119-35-8 is the registry number for (-)-Muscarine Chloride. Offered by: TRC. Available pack sizes: 100mg.
[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium chloride (CAS 35119-35-8) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: [(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium chloride. InChIKey: WUFRNEJYZWHXLC-ZXKHYXLDSA-M.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | [(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium chloride |
| InChIKey | WUFRNEJYZWHXLC-ZXKHYXLDSA-M |
| SMILES | C[C@@H]1[C@H](C[C@@H](O1)C[N+](C)(C)C)O.[Cl-] |
Computed by PubChem (NCBI)