CAS 2303597-00-2 is the registry number for 7-Chloro-4-methoxybenzo[d]oxazol-6-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-4-methoxy-1,3-benzoxazol-6-amine (CAS 2303597-00-2) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 7-chloro-4-methoxy-1,3-benzoxazol-6-amine. InChIKey: AQSBERNLWOJEIF-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 7-chloro-4-methoxy-1,3-benzoxazol-6-amine |
| InChIKey | AQSBERNLWOJEIF-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C(=C1)N)Cl)OC=N2 |
Computed by PubChem (NCBI)