CAS 2305253-81-8 is the registry number for 7-Aminoquinazolin-4(3H)-one hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
7-amino-3H-quinazolin-4-one;hydrochloride (CAS 2305253-81-8) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 7-amino-3H-quinazolin-4-one;hydrochloride. InChIKey: FLEISPYUKWNLMR-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 7-amino-3H-quinazolin-4-one;hydrochloride |
| InChIKey | FLEISPYUKWNLMR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)N=CNC2=O.Cl |
Computed by PubChem (NCBI)