Products 2307736-89-4
CAS 2307736-89-4 is the registry number for rac-((2R,4S)-4-Methoxyoxan-2-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(2S,4R)-4-methoxyoxan-2-yl]methanamine;hydrochloride (CAS 2307736-89-4) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: [(2S,4R)-4-methoxyoxan-2-yl]methanamine;hydrochloride. InChIKey: QJGLFSOUQNPVPZ-HHQFNNIRSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | [(2S,4R)-4-methoxyoxan-2-yl]methanamine;hydrochloride |
| InChIKey | QJGLFSOUQNPVPZ-HHQFNNIRSA-N |
| SMILES | CO[C@@H]1CCO[C@@H](C1)CN.Cl |
Computed by PubChem (NCBI)