CAS 2322675-90-9 is the registry number for Boc-L-Tyr(O,3,5-Me3)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg.
(2S)-3-(4-methoxy-3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2322675-90-9) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: (2S)-3-(4-methoxy-3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KDHQPZJIQZWSCM-ZDUSSCGKSA-N.
| Molecular formula | C17H25NO5 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (2S)-3-(4-methoxy-3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KDHQPZJIQZWSCM-ZDUSSCGKSA-N |
| SMILES | CC1=CC(=CC(=C1OC)C)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)