Products 2365418-78-4
CAS 2365418-78-4 appears in our catalog under these names: Methyl 4-hydroxy-3-(methylamino)benzoate hydrochloride, 96%, Methyl 4-hydroxy-3-(methylamino)benzoate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Methyl 4-hydroxy-3-(methylamino)benzoate;hydrochloride (CAS 2365418-78-4) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: methyl 4-hydroxy-3-(methylamino)benzoate;hydrochloride. InChIKey: OQQDCTRMANZONH-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | methyl 4-hydroxy-3-(methylamino)benzoate;hydrochloride |
| InChIKey | OQQDCTRMANZONH-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=C1)C(=O)OC)O.Cl |
Computed by PubChem (NCBI)