Products 2375250-75-0
CAS 2375250-75-0 is the registry number for (3R,8aS)-Hexahydro-1H-pyrrolo(2,1-c)morpholine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3-carboxylic acid;hydrochloride (CAS 2375250-75-0) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: (3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3-carboxylic acid;hydrochloride. InChIKey: XOZIDVNNVPCGQT-UOERWJHTSA-N.
| Molecular formula | C8H14ClNO3 |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | (3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3-carboxylic acid;hydrochloride |
| InChIKey | XOZIDVNNVPCGQT-UOERWJHTSA-N |
| SMILES | C1C[C@H]2CO[C@H](CN2C1)C(=O)O.Cl |
Computed by PubChem (NCBI)