CAS 2375259-76-8 is the registry number for Ethyl 4-amino-2-oxabicyclo(2.1.1)hexane-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 4-amino-2-oxabicyclo[2.1.1]hexane-1-carboxylate;hydrochloride (CAS 2375259-76-8) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: ethyl 4-amino-2-oxabicyclo[2.1.1]hexane-1-carboxylate;hydrochloride. InChIKey: YDUWRLPXVWKIGH-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO3 |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | ethyl 4-amino-2-oxabicyclo[2.1.1]hexane-1-carboxylate;hydrochloride |
| InChIKey | YDUWRLPXVWKIGH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C12CC(C1)(CO2)N.Cl |
Computed by PubChem (NCBI)