Products 2375267-99-3
CAS 2375267-99-3 is the registry number for Methyl 1-(aminomethyl)-3,3-difluorocyclobutane-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 1-(aminomethyl)-3,3-difluorocyclobutane-1-carboxylate;hydrochloride (CAS 2375267-99-3) is a chemical compound with the molecular formula C7H12ClF2NO2 and a molecular weight of 215.62 g/mol. IUPAC name: methyl 1-(aminomethyl)-3,3-difluorocyclobutane-1-carboxylate;hydrochloride. InChIKey: QIGAHUAHOPPUJZ-UHFFFAOYSA-N.
| Molecular formula | C7H12ClF2NO2 |
|---|---|
| Molecular weight | 215.62 g/mol |
| IUPAC name | methyl 1-(aminomethyl)-3,3-difluorocyclobutane-1-carboxylate;hydrochloride |
| InChIKey | QIGAHUAHOPPUJZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC(C1)(F)F)CN.Cl |
Computed by PubChem (NCBI)