Products 2375273-07-5
CAS 2375273-07-5 is the registry number for 1-(2-Sulfamoylethyl)cyclobutane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2-sulfamoylethyl)cyclobutane-1-carboxylic acid (CAS 2375273-07-5) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: 1-(2-sulfamoylethyl)cyclobutane-1-carboxylic acid. InChIKey: BMPXCHPVFPZYHU-UHFFFAOYSA-N.
| Molecular formula | C7H13NO4S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 1-(2-sulfamoylethyl)cyclobutane-1-carboxylic acid |
| InChIKey | BMPXCHPVFPZYHU-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CCS(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)