Products 2379321-48-7
CAS 2379321-48-7 appears in our catalog under these names: 4-(Trifluoromethoxy)-[1,1'-biphenyl]-2-carboxylic acid, 95%, 4-(Trifluoromethoxy)-[1,1'-biphenyl]-2-carboxylic acid, ≥95%, ≥95%, 4-(Trifluoromethoxy)-[1,1'-biphenyl]-2-carboxylic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
2-phenyl-5-(trifluoromethoxy)benzoic acid (CAS 2379321-48-7) is a chemical compound with the molecular formula C14H9F3O3 and a molecular weight of 282.21 g/mol. IUPAC name: 2-phenyl-5-(trifluoromethoxy)benzoic acid. InChIKey: KSGILMDSANZXJP-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O3 |
|---|---|
| Molecular weight | 282.21 g/mol |
| IUPAC name | 2-phenyl-5-(trifluoromethoxy)benzoic acid |
| InChIKey | KSGILMDSANZXJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)