CAS 728919-11-7 appears in our catalog under these names: 4-(4-Trifluoromethoxyphenyl)benzoic acid, 98%, 4'-Trifluoromethoxy-biphenyl-4-carboxylic acid, 98%, 4'-(Trifluoromethoxy)-[1,1'-biphenyl]-4-carboxylic acid 98%, 4-(4-Trifluoromethoxyphenyl)benzoic acid, 98%, 98%, 4'-Trifluoromethoxy-biphenyl-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100mg, 250mg.
4-[4-(trifluoromethoxy)phenyl]benzoic acid (CAS 728919-11-7) is a chemical compound with the molecular formula C14H9F3O3 and a molecular weight of 282.21 g/mol. IUPAC name: 4-[4-(trifluoromethoxy)phenyl]benzoic acid. InChIKey: YZWGBLHLQLDTMZ-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O3 |
|---|---|
| Molecular weight | 282.21 g/mol |
| IUPAC name | 4-[4-(trifluoromethoxy)phenyl]benzoic acid |
| InChIKey | YZWGBLHLQLDTMZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)