CAS 78161-82-7 appears in our catalog under these names: 4-[4-(Trifluoromethyl)phenoxy]benzoic acid, 98%, 4-(4-(Trifluoromethyl)phenoxy)benzoic acid, 95%, 4–(4–(Trifluoromethyl)phenoxy)benzoic acid, 4-(4-(Trifluoromethyl)phenoxy)benzoic acid 95%, 4-(4-(Trifluoromethyl)phenoxy)benzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100mg, 250mg.
4-[4-(trifluoromethyl)phenoxy]benzoic acid (CAS 78161-82-7) is a chemical compound with the molecular formula C14H9F3O3 and a molecular weight of 282.21 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenoxy]benzoic acid. InChIKey: REDYCJOUKXVWEZ-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O3 |
|---|---|
| Molecular weight | 282.21 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenoxy]benzoic acid |
| InChIKey | REDYCJOUKXVWEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)