CAS 2650309-60-5 is the registry number for 6-(trifluoromethyl)-3,4-dihydro-1H-xanthene-1,9(2H)-dione. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)-3,4-dihydro-2H-xanthene-1,9-dione (CAS 2650309-60-5) is a chemical compound with the molecular formula C14H9F3O3 and a molecular weight of 282.21 g/mol. IUPAC name: 6-(trifluoromethyl)-3,4-dihydro-2H-xanthene-1,9-dione. InChIKey: YCBJUIHLMYFQSQ-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O3 |
|---|---|
| Molecular weight | 282.21 g/mol |
| IUPAC name | 6-(trifluoromethyl)-3,4-dihydro-2H-xanthene-1,9-dione |
| InChIKey | YCBJUIHLMYFQSQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=O)C3=C(O2)C=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)