CAS 6641-59-4 appears in our catalog under these names: 3-(3-Trifluoromethyl-phenoxy)benzoic acid, 95%, 2-(3-(Trifluoromethyl)phenoxy)benzoic acid, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g, on request.
2-[3-(trifluoromethyl)phenoxy]benzoic acid (CAS 6641-59-4) is a chemical compound with the molecular formula C14H9F3O3 and a molecular weight of 282.21 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenoxy]benzoic acid. InChIKey: XIFJQCRCHLSUSL-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O3 |
|---|---|
| Molecular weight | 282.21 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenoxy]benzoic acid |
| InChIKey | XIFJQCRCHLSUSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)