CAS 408366-18-7 appears in our catalog under these names: 2-(4-Trifluoromethoxyphenyl)benzoic acid, 98%, 4'-(Trifluoromethoxy)-(1,1'-biphenyl)-2-carboxylic acid, 98%, 4'-(Trifluoromethoxy)-[1,1'-biphenyl]-2-carboxylic acid, 98%, 98%, 4'-Trifluoromethoxy-biphenyl-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
2-[4-(trifluoromethoxy)phenyl]benzoic acid (CAS 408366-18-7) is a chemical compound with the molecular formula C14H9F3O3 and a molecular weight of 282.21 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenyl]benzoic acid. InChIKey: JPLHXHHURMRLGR-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O3 |
|---|---|
| Molecular weight | 282.21 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenyl]benzoic acid |
| InChIKey | JPLHXHHURMRLGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)