CAS 728919-12-8 is the registry number for 4'-(Trifluoromethoxy)biphenyl-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[4-(trifluoromethoxy)phenyl]benzoic acid (CAS 728919-12-8) is a chemical compound with the molecular formula C14H9F3O3 and a molecular weight of 282.21 g/mol. IUPAC name: 3-[4-(trifluoromethoxy)phenyl]benzoic acid. InChIKey: VUUCZDXUSBMEDB-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O3 |
|---|---|
| Molecular weight | 282.21 g/mol |
| IUPAC name | 3-[4-(trifluoromethoxy)phenyl]benzoic acid |
| InChIKey | VUUCZDXUSBMEDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)