Products 400744-89-0

CAS 400744-89-0 is the registry number for 4-Hydroxy-2'-trifluoromethyl-biphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-hydroxy-5-[2-(trifluoromethyl)phenyl]benzoic acid (CAS 400744-89-0) is a chemical compound with the molecular formula C14H9F3O3 and a molecular weight of 282.21 g/mol. IUPAC name: 2-hydroxy-5-[2-(trifluoromethyl)phenyl]benzoic acid. InChIKey: NCKNIKWPHLFUQN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9F3O3
Molecular weight282.21 g/mol
IUPAC name2-hydroxy-5-[2-(trifluoromethyl)phenyl]benzoic acid
InChIKeyNCKNIKWPHLFUQN-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC(=C(C=C2)O)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)