Products 2381621-49-2
CAS 2381621-49-2 is the registry number for 2-(tert-Butyl) 3-ethyl (1R,3R,4R)-5-oxo-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
2-O-tert-butyl 3-O-ethyl (1R,3R,4R)-5-oxo-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate (CAS 2381621-49-2) is a chemical compound with the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. IUPAC name: 2-O-tert-butyl 3-O-ethyl (1R,3R,4R)-5-oxo-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate. InChIKey: VSHIYGMRWBFMTP-JFGNBEQYSA-N.
| Molecular formula | C15H23NO5 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-ethyl (1R,3R,4R)-5-oxo-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate |
| InChIKey | VSHIYGMRWBFMTP-JFGNBEQYSA-N |
| SMILES | CCOC(=O)[C@H]1[C@H]2CC[C@@H](N1C(=O)OC(C)(C)C)CC2=O |
Computed by PubChem (NCBI)