CAS 2387568-79-6 appears in our catalog under these names: (2S)-2-amino-3-cyclooctyl-propanoic acid,hydrochloride, 97%, 97%, (2S)-2-AMINO-3-CYCLOOCTYLPROPANOIC ACID HYDROCHLORIDE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
(2S)-2-amino-3-cyclooctylpropanoic acid;hydrochloride (CAS 2387568-79-6) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: (2S)-2-amino-3-cyclooctylpropanoic acid;hydrochloride. InChIKey: MKRNVSMIDNZRFX-PPHPATTJSA-N.
| Molecular formula | C11H22ClNO2 |
|---|---|
| Molecular weight | 235.75 g/mol |
| IUPAC name | (2S)-2-amino-3-cyclooctylpropanoic acid;hydrochloride |
| InChIKey | MKRNVSMIDNZRFX-PPHPATTJSA-N |
| SMILES | C1CCCC(CCC1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)