Products 77075-24-2

CAS 77075-24-2 is the registry number for Ethyl 3-((1r,4r)-4-aminocyclohexyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-(4-aminocyclohexyl)propanoate;hydrochloride (CAS 77075-24-2) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: ethyl 3-(4-aminocyclohexyl)propanoate;hydrochloride. InChIKey: QQHYOQPKPTXXKN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22ClNO2
Molecular weight235.75 g/mol
IUPAC nameethyl 3-(4-aminocyclohexyl)propanoate;hydrochloride
InChIKeyQQHYOQPKPTXXKN-UHFFFAOYSA-N
SMILESCCOC(=O)CCC1CCC(CC1)N.Cl

Computed by PubChem (NCBI)