Products 2270906-34-6

CAS 2270906-34-6 is the registry number for 4-(4,4-Dimethyl-piperidin-1-yl)-butyric acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(4,4-dimethylpiperidin-1-yl)butanoic acid;hydrochloride (CAS 2270906-34-6) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: 4-(4,4-dimethylpiperidin-1-yl)butanoic acid;hydrochloride. InChIKey: UKOPJLHWWXVFFS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22ClNO2
Molecular weight235.75 g/mol
IUPAC name4-(4,4-dimethylpiperidin-1-yl)butanoic acid;hydrochloride
InChIKeyUKOPJLHWWXVFFS-UHFFFAOYSA-N
SMILESCC1(CCN(CC1)CCCC(=O)O)C.Cl

Computed by PubChem (NCBI)