CAS 52598-90-0 appears in our catalog under these names: (2,2,6,6-Tetramethyl-4-piperidinyl)acetic acid hydrochloride, 95%, (2,2,6,6-tetramethyl-4-piperidinyl)acetic acid hydrochloride, 97%, 97%, (2,2,6,6-tetramethyl-4-piperidinyl)acetic acid hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 5g, 1g, 100mg, 250mg.
2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid;hydrochloride (CAS 52598-90-0) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: 2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid;hydrochloride. InChIKey: KJYVYQNKXSZKFC-UHFFFAOYSA-N.
| Molecular formula | C11H22ClNO2 |
|---|---|
| Molecular weight | 235.75 g/mol |
| IUPAC name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid;hydrochloride |
| InChIKey | KJYVYQNKXSZKFC-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)CC(=O)O)C.Cl |
Computed by PubChem (NCBI)