Products 1437312-00-9

CAS 1437312-00-9 is the registry number for 1-(1-Ethylpropyl)piperidine-4-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

1-pentan-3-ylpiperidine-4-carboxylic acid;hydrochloride (CAS 1437312-00-9) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: 1-pentan-3-ylpiperidine-4-carboxylic acid;hydrochloride. InChIKey: KNMSOLPODKAQDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22ClNO2
Molecular weight235.75 g/mol
IUPAC name1-pentan-3-ylpiperidine-4-carboxylic acid;hydrochloride
InChIKeyKNMSOLPODKAQDQ-UHFFFAOYSA-N
SMILESCCC(CC)N1CCC(CC1)C(=O)O.Cl

Computed by PubChem (NCBI)