Products 2270910-68-2

CAS 2270910-68-2 is the registry number for (3,3-Dimethyl-piperidin-4-yl)-acetic acid ethyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Ethyl 2-(3,3-dimethylpiperidin-4-yl)acetate;hydrochloride (CAS 2270910-68-2) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: ethyl 2-(3,3-dimethylpiperidin-4-yl)acetate;hydrochloride. InChIKey: HDRXZKJRMBFBJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22ClNO2
Molecular weight235.75 g/mol
IUPAC nameethyl 2-(3,3-dimethylpiperidin-4-yl)acetate;hydrochloride
InChIKeyHDRXZKJRMBFBJQ-UHFFFAOYSA-N
SMILESCCOC(=O)CC1CCNCC1(C)C.Cl

Computed by PubChem (NCBI)