CAS 104094-97-5 appears in our catalog under these names: Ethyl 2-(2,2-dimethylpiperidin-4-yl)acetate hydrochloride, 95%, Ethyl 2–(2,2–dimethylpiperidin–4–yl)acetate hydrochloride, Ethyl 2-(2,2-dimethylpiperidin-4-yl)acetate hydrochloride, Ethyl 2-(2,2-dimethylpiperidin-4-yl)acetate hydrochloride 95%, Ethyl 2-(2,2-dimethylpiperidin-4-yl)acetate hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g, 50mg, 0,5g.
Ethyl 2-(2,2-dimethylpiperidin-4-yl)acetate;hydrochloride (CAS 104094-97-5) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: ethyl 2-(2,2-dimethylpiperidin-4-yl)acetate;hydrochloride. InChIKey: RCMAJVJVLAXDLA-UHFFFAOYSA-N.
| Molecular formula | C11H22ClNO2 |
|---|---|
| Molecular weight | 235.75 g/mol |
| IUPAC name | ethyl 2-(2,2-dimethylpiperidin-4-yl)acetate;hydrochloride |
| InChIKey | RCMAJVJVLAXDLA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1CCNC(C1)(C)C.Cl |
Computed by PubChem (NCBI)