CAS 2174007-91-9 appears in our catalog under these names: tert-butyl 2-(piperidin-4-yl)acetate hydrochloride, 95%, tert-Butyl 2-(piperidin-4-yl)acetate hydrochloride, 95%, 95%, tert-Butyl 2-(piperidin-4-yl)acetate hydrochloride, tert-Butyl 2-(piperidin-4-yl)acetate hydrochloride 95%. Offered by: Combi-blocks, Chemat, MedChemExpress, Ambeed. Available pack sizes: 5g, 250mg, 100mg, 1g, 10g, Get quote, 25g.
Tert-butyl 2-piperidin-4-ylacetate;hydrochloride (CAS 2174007-91-9) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: tert-butyl 2-piperidin-4-ylacetate;hydrochloride. InChIKey: AXNZZFDNHDADAI-UHFFFAOYSA-N.
| Molecular formula | C11H22ClNO2 |
|---|---|
| Molecular weight | 235.75 g/mol |
| IUPAC name | tert-butyl 2-piperidin-4-ylacetate;hydrochloride |
| InChIKey | AXNZZFDNHDADAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1CCNCC1.Cl |
Computed by PubChem (NCBI)