CAS 24032-35-7 appears in our catalog under these names: H-Glu-pna, 95%, H–Glu–pNA, H-Glu-Pna, ≥98%, ≥98%, H-Glu-pNA, H-Glu-Pna, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 500mg, Get quote.
(4S)-4-amino-5-(4-nitroanilino)-5-oxopentanoic acid (CAS 24032-35-7) is a chemical compound with the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. IUPAC name: (4S)-4-amino-5-(4-nitroanilino)-5-oxopentanoic acid. InChIKey: JXQXNQKTUGNZLD-VIFPVBQESA-N.
| Molecular formula | C11H13N3O5 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | (4S)-4-amino-5-(4-nitroanilino)-5-oxopentanoic acid |
| InChIKey | JXQXNQKTUGNZLD-VIFPVBQESA-N |
| SMILES | C1=CC(=CC=C1NC(=O)[C@H](CCC(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)