Products 91332-91-1
CAS 91332-91-1 is the registry number for 2'-(Methylamino)-5'-nitro-succinanilic Acid. Offered by: TRC. Available pack sizes: 1g, 2,5g, 5g.
4-[2-(methylamino)-5-nitroanilino]-4-oxobutanoic acid (CAS 91332-91-1) is a chemical compound with the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. IUPAC name: 4-[2-(methylamino)-5-nitroanilino]-4-oxobutanoic acid. InChIKey: UIMTXPIELUIYSI-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O5 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 4-[2-(methylamino)-5-nitroanilino]-4-oxobutanoic acid |
| InChIKey | UIMTXPIELUIYSI-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)[N+](=O)[O-])NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)