Products 2639627-75-9
CAS 2639627-75-9 is the registry number for [(E)-2-(2-Methoxy-4,6-dinitrophenyl)ethenyl]dimethylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(E)-2-(2-methoxy-4,6-dinitrophenyl)-N,N-dimethylethenamine (CAS 2639627-75-9) is a chemical compound with the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. IUPAC name: (E)-2-(2-methoxy-4,6-dinitrophenyl)-N,N-dimethylethenamine. InChIKey: SRDKTXQJRJNUBK-SNAWJCMRSA-N.
| Molecular formula | C11H13N3O5 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | (E)-2-(2-methoxy-4,6-dinitrophenyl)-N,N-dimethylethenamine |
| InChIKey | SRDKTXQJRJNUBK-SNAWJCMRSA-N |
| SMILES | CN(C)/C=C/C1=C(C=C(C=C1OC)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)