Products 60133-17-7
CAS 60133-17-7 appears in our catalog under these names: H-D-Glu(pNA)-OH, H–D–Glu(pNA)–OH. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 50mg, 250mg, 500mg, 1000mg.
(2R)-2-amino-5-(4-nitroanilino)-5-oxopentanoic acid (CAS 60133-17-7) is a chemical compound with the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. IUPAC name: (2R)-2-amino-5-(4-nitroanilino)-5-oxopentanoic acid. InChIKey: WMZTYIRRBCGARG-SECBINFHSA-N.
| Molecular formula | C11H13N3O5 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | (2R)-2-amino-5-(4-nitroanilino)-5-oxopentanoic acid |
| InChIKey | WMZTYIRRBCGARG-SECBINFHSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CC[C@H](C(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)