CAS 60827-79-4 is the registry number for Cytidine Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] acetate (CAS 60827-79-4) is a chemical compound with the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. IUPAC name: [(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] acetate. InChIKey: IIZVAGGHCDBAIK-SFKDOBOXSA-N.
| Molecular formula | C11H13N3O5 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | [(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] acetate |
| InChIKey | IIZVAGGHCDBAIK-SFKDOBOXSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](O[C@@H]2[C@H]1OC3=NC(=N)C=CN23)CO |
Computed by PubChem (NCBI)