CAS 899430-49-0 is the registry number for 3–(2–Azido–2–(2–hydroxyethoxy)ethoxy)benzoic acid. Offered by: GLPBio. Available pack sizes: 250mg.
3-[2-azido-2-(2-hydroxyethoxy)ethoxy]benzoic acid (CAS 899430-49-0) is a chemical compound with the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. IUPAC name: 3-[2-azido-2-(2-hydroxyethoxy)ethoxy]benzoic acid. InChIKey: ZRCRIXHIOXHRDG-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O5 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 3-[2-azido-2-(2-hydroxyethoxy)ethoxy]benzoic acid |
| InChIKey | ZRCRIXHIOXHRDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(N=[N+]=[N-])OCCO)C(=O)O |
Computed by PubChem (NCBI)