CAS 39007-52-8 appears in our catalog under these names: N4-Ethenocytidine, 95%, N4-Ethenocytidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 500mg.
6-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazo[1,2-c]pyrimidin-5-one (CAS 39007-52-8) is a chemical compound with the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. IUPAC name: 6-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazo[1,2-c]pyrimidin-5-one. InChIKey: DUCZQUFMCSTEHH-PEBGCTIMSA-N.
| Molecular formula | C11H13N3O5 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 6-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazo[1,2-c]pyrimidin-5-one |
| InChIKey | DUCZQUFMCSTEHH-PEBGCTIMSA-N |
| SMILES | C1=CN(C(=O)N2C1=NC=C2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)