CAS 7300-59-6 appears in our catalog under these names: L-Glutamic Acid gamma-p-Nitroanilide, L–γ–Glutamyl–p–nitroanilide Monohydrate, H-Glu(pNA)-OH, L-gamma-Glutamyl-p-nitroanilide Monohydrate, >98.0%(HPLC)(T), L-GLUTAMIC ACID GAMMA-(P-NITROANILIDE) &. Offered by: TRC, GLPBio, Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, 2g, 10g, 50g, 100mg, 250mg.
(2S)-2-amino-5-(4-nitroanilino)-5-oxopentanoic acid (CAS 7300-59-6) is a chemical compound with the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. IUPAC name: (2S)-2-amino-5-(4-nitroanilino)-5-oxopentanoic acid. InChIKey: WMZTYIRRBCGARG-VIFPVBQESA-N.
| Molecular formula | C11H13N3O5 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | (2S)-2-amino-5-(4-nitroanilino)-5-oxopentanoic acid |
| InChIKey | WMZTYIRRBCGARG-VIFPVBQESA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CC[C@@H](C(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)