CAS 2408963-62-0 is the registry number for tert-Butyl 2-(3,5-dioxothiomorpholin-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 2-(3,5-dioxothiomorpholin-2-yl)acetate (CAS 2408963-62-0) is a chemical compound with the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. IUPAC name: tert-butyl 2-(3,5-dioxothiomorpholin-2-yl)acetate. InChIKey: DJKMEKURCWDTDC-UHFFFAOYSA-N.
| Molecular formula | C10H15NO4S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | tert-butyl 2-(3,5-dioxothiomorpholin-2-yl)acetate |
| InChIKey | DJKMEKURCWDTDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1C(=O)NC(=O)CS1 |
Computed by PubChem (NCBI)