Products 2408963-62-0

CAS 2408963-62-0 is the registry number for tert-Butyl 2-(3,5-dioxothiomorpholin-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(3,5-dioxothiomorpholin-2-yl)acetate (CAS 2408963-62-0) is a chemical compound with the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. IUPAC name: tert-butyl 2-(3,5-dioxothiomorpholin-2-yl)acetate. InChIKey: DJKMEKURCWDTDC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15NO4S
Molecular weight245.30 g/mol
IUPAC nametert-butyl 2-(3,5-dioxothiomorpholin-2-yl)acetate
InChIKeyDJKMEKURCWDTDC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CC1C(=O)NC(=O)CS1

Computed by PubChem (NCBI)