Products 2410654-80-5
CAS 2410654-80-5 is the registry number for (1S,2R)-2-(4- bromophenyl)-Cyclopropanecarboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg.
Cis-(1S,2R)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid (CAS 2410654-80-5) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: cis-(1S,2R)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid. InChIKey: DPBUJVBXRABXRH-IUCAKERBSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | cis-(1S,2R)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | DPBUJVBXRABXRH-IUCAKERBSA-N |
| SMILES | C1[C@H]([C@H]1C(=O)O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)