CAS 1123620-89-2 appears in our catalog under these names: trans–2–(4–broMophenyl)cyclopropanecarboxylic acid, (1S,2S)-2-(4-Bromophenyl)cyclopropanecarboxylic acid, 95%, (1S,2S)-2-(4-Bromophenyl)cyclopropanecarboxylic acid, 95%+, (1S,2S)-2-(4-Bromophenyl)cyclopropanecarboxylic acid, 95%+, 95%+. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
Trans-(1S,2S)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid (CAS 1123620-89-2) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: trans-(1S,2S)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid. InChIKey: DPBUJVBXRABXRH-BDAKNGLRSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | trans-(1S,2S)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | DPBUJVBXRABXRH-BDAKNGLRSA-N |
| SMILES | C1[C@@H]([C@H]1C(=O)O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)